PF-06835919 Catalog No.:M33609-C Smiles: CC1(C)CN(C(C(=O)NO)N(C1)S(=O)(=O)C1C=CC(=CC=1)OC)S(=O)(=O)C1C=CC(=CC=1)OC

Smiles: CC1(C)CN(C(C(=O)NO)N(C1)S(=O)(=O)C1C=CC(=CC=1)OC)S(=O)(=O)C1C=CC(=CC=1)OC

YM158 for LTD4 and TXA2 receptors are exhibited at the same dose range

InChiKey: KCBJGVDOSBKVKP-UHFFFAOYSA-N

Chemical Name: ethyl 3-{1-[2-({[4-({[(hexyloxy)carbonyl]amino}methanimidoyl)phenyl]amino}methyl)-1-methyl-1H-1

PF-06835919 Catalog No.:M33609-C Smiles: CC1(C)CN(C(C(=O)NO)N(C1)S(=O)(=O)C1C=CC(=CC=1)OC)S(=O)(=O)C1C=CC(=CC=1)OCPF 06835919, also known as MDK1846, is a potent ketohexokinase (KHK) inhibitor. PF 06835919 is reported in patent US 20170183328 A1, example 4. Increased fructose consumption and its subsequent metabolism have been implicated in hepatic steatosis, dyslipidemia, obesity, and insulin resistance in humans. Since ketohexokinase (KHK) is the principal enzyme responsible for fructose metabolism, identification of a selective KHK inhibitor may help to